C9H12N2O2 — CID 10607461
(2S,6R)-4,4-dimethyl-3,5-dioxa-8,10-diazatricyclo[6.3.0.02,6]undeca-1(11),9-diene (PubChem CID 10607461) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is (2S,6R)-4,4-dimethyl-3,5-dioxa-8,10-diazatricyclo[6.3.0.02,6]undeca-1(11),9-diene.
| Compound Name | (2S,6R)-4,4-dimethyl-3,5-dioxa-8,10-diazatricyclo[6.3.0.02,6]undeca-1(11),9-diene |
|---|---|
| PubChem CID | 10607461 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (2S,6R)-4,4-dimethyl-3,5-dioxa-8,10-diazatricyclo[6.3.0.02,6]undeca-1(11),9-diene |
| SMILES | CC1(C)O[C@@H]2Cn3cncc3[C@@H]2O1 |
| InChI | InChI=1S/C9H12N2O2/c1-9(2)12-7-4-11-5-10-3-6(11)8(7)13-9/h3,5,7-8H,4H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | IWGWIOARXDGTCI-SFYZADRCSA-N |
| XLogP | 1.09 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |