About 4,4-diethoxy-2,3-dimethylcyclobut-2-en-1-one
4,4-diethoxy-2,3-dimethylcyclobut-2-en-1-one (PubChem CID 10607539) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is 4,4-diethoxy-2,3-dimethylcyclobut-2-en-1-one.
Molecular Properties
| Compound Name | 4,4-diethoxy-2,3-dimethylcyclobut-2-en-1-one |
| PubChem CID | 10607539 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 4,4-diethoxy-2,3-dimethylcyclobut-2-en-1-one |
| SMILES | CCOC1(OCC)C(=O)C(C)=C1C |
| InChI | InChI=1S/C10H16O3/c1-5-12-10(13-6-2)8(4)7(3)9(10)11/h5-6H2,1-4H3 |
| InChIKey | STRBLHPZCASWOV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4,4-diethoxy-2,3-dimethylcyclobut-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-diethoxy-2,3-dimethylcyclobut-2-en-1-one?
The IUPAC name of 4,4-diethoxy-2,3-dimethylcyclobut-2-en-1-one (CID 10607539) is 4,4-diethoxy-2,3-dimethylcyclobut-2-en-1-one.
What is the SMILES notation for 4,4-diethoxy-2,3-dimethylcyclobut-2-en-1-one?
The canonical SMILES for 4,4-diethoxy-2,3-dimethylcyclobut-2-en-1-one is CCOC1(OCC)C(=O)C(C)=C1C.
What is the InChIKey of 4,4-diethoxy-2,3-dimethylcyclobut-2-en-1-one?
The InChIKey is STRBLHPZCASWOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-5-12-10(13-6-2)8(4)7(3)9(10)11/h5-6H2,1-4H3.
What are the key properties of 4,4-diethoxy-2,3-dimethylcyclobut-2-en-1-one?
4,4-diethoxy-2,3-dimethylcyclobut-2-en-1-one has a molecular weight of 184.23 g/mol, XLogP of 1.67, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-diethoxy-2,3-dimethylcyclobut-2-en-1-one is sourced from PubChem (CID 10607539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).