About [5-(methylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]urea
[5-(methylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]urea (PubChem CID 10607569) has the molecular formula C6H11N5O2
and a molecular weight of 185.19 g/mol. Its IUPAC name is [5-(methylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]urea.
Molecular Properties
| Compound Name | [5-(methylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]urea |
| PubChem CID | 10607569 |
| Molecular Formula | C6H11N5O2 |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | [5-(methylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]urea |
| SMILES | CNC1CN=C(NC(N)=O)NC1=O |
| InChI | InChI=1S/C6H11N5O2/c1-8-3-2-9-6(10-4(3)12)11-5(7)13/h3,8H,2H2,1H3,(H4,7,9,10,11,12,13) |
| InChIKey | YZYUOXBMEKWXLI-UHFFFAOYSA-N |
| XLogP | -2.27 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(methylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(methylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]urea?
The IUPAC name of [5-(methylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]urea (CID 10607569) is [5-(methylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]urea.
What is the SMILES notation for [5-(methylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]urea?
The canonical SMILES for [5-(methylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]urea is CNC1CN=C(NC(N)=O)NC1=O.
What is the InChIKey of [5-(methylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]urea?
The InChIKey is YZYUOXBMEKWXLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N5O2/c1-8-3-2-9-6(10-4(3)12)11-5(7)13/h3,8H,2H2,1H3,(H4,7,9,10,11,12,13).
What are the key properties of [5-(methylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]urea?
[5-(methylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]urea has a molecular weight of 185.19 g/mol, XLogP of -2.27, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(methylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]urea is sourced from PubChem (CID 10607569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).