C14H23BrN2O2S — CID 106076580
N-(2-bromo-5-methylphenyl)-4-(propylamino)butane-1-sulfonamide (PubChem CID 106076580) has the molecular formula C14H23BrN2O2S and a molecular weight of 363.32 g/mol. Its IUPAC name is N-(2-bromo-5-methylphenyl)-4-(propylamino)butane-1-sulfonamide.
| Compound Name | N-(2-bromo-5-methylphenyl)-4-(propylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106076580 |
| Molecular Formula | C14H23BrN2O2S |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | N-(2-bromo-5-methylphenyl)-4-(propylamino)butane-1-sulfonamide |
| SMILES | CCCNCCCCS(=O)(=O)Nc1cc(C)ccc1Br |
| InChI | InChI=1S/C14H23BrN2O2S/c1-3-8-16-9-4-5-10-20(18,19)17-14-11-12(2)6-7-13(14)15/h6-7,11,16-17H,3-5,8-10H2,1-2H3 |
| InChIKey | SYKLJVJGIGNMQW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|