About pent-4-enyl 2H-pyridine-1-carboxylate
pent-4-enyl 2H-pyridine-1-carboxylate (PubChem CID 10607813) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is pent-4-enyl 2H-pyridine-1-carboxylate.
Molecular Properties
| Compound Name | pent-4-enyl 2H-pyridine-1-carboxylate |
| PubChem CID | 10607813 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | pent-4-enyl 2H-pyridine-1-carboxylate |
| SMILES | C=CCCCOC(=O)N1C=CC=CC1 |
| InChI | InChI=1S/C11H15NO2/c1-2-3-7-10-14-11(13)12-8-5-4-6-9-12/h2,4-6,8H,1,3,7,9-10H2 |
| InChIKey | CHLXUACRURYFAY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze pent-4-enyl 2H-pyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-4-enyl 2H-pyridine-1-carboxylate?
The IUPAC name of pent-4-enyl 2H-pyridine-1-carboxylate (CID 10607813) is pent-4-enyl 2H-pyridine-1-carboxylate.
What is the SMILES notation for pent-4-enyl 2H-pyridine-1-carboxylate?
The canonical SMILES for pent-4-enyl 2H-pyridine-1-carboxylate is C=CCCCOC(=O)N1C=CC=CC1.
What is the InChIKey of pent-4-enyl 2H-pyridine-1-carboxylate?
The InChIKey is CHLXUACRURYFAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-2-3-7-10-14-11(13)12-8-5-4-6-9-12/h2,4-6,8H,1,3,7,9-10H2.
What are the key properties of pent-4-enyl 2H-pyridine-1-carboxylate?
pent-4-enyl 2H-pyridine-1-carboxylate has a molecular weight of 193.25 g/mol, XLogP of 2.47, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pent-4-enyl 2H-pyridine-1-carboxylate is sourced from PubChem (CID 10607813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).