C13H22N2O2S4 — CID 106078382
N-(1,4-dithian-2-ylmethyl)-5-(propylaminomethyl)thiophene-3-sulfonamide (PubChem CID 106078382) has the molecular formula C13H22N2O2S4 and a molecular weight of 366.60 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)-5-(propylaminomethyl)thiophene-3-sulfonamide.
| Compound Name | N-(1,4-dithian-2-ylmethyl)-5-(propylaminomethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106078382 |
| Molecular Formula | C13H22N2O2S4 |
| Molecular Weight | 366.60 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)-5-(propylaminomethyl)thiophene-3-sulfonamide |
| SMILES | CCCNCc1cc(S(=O)(=O)NCC2CSCCS2)cs1 |
| InChI | InChI=1S/C13H22N2O2S4/c1-2-3-14-7-11-6-13(10-20-11)21(16,17)15-8-12-9-18-4-5-19-12/h6,10,12,14-15H,2-5,7-9H2,1H3 |
| InChIKey | FIWNCORRSNNCEZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.60 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|