C12H20O2 — CID 10607944
(4R,5R)-2-ethenyl-4,5-dimethyl-2-(3-methylbut-3-enyl)-1,3-dioxolane (PubChem CID 10607944) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (4R,5R)-2-ethenyl-4,5-dimethyl-2-(3-methylbut-3-enyl)-1,3-dioxolane.
| Compound Name | (4R,5R)-2-ethenyl-4,5-dimethyl-2-(3-methylbut-3-enyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 10607944 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (4R,5R)-2-ethenyl-4,5-dimethyl-2-(3-methylbut-3-enyl)-1,3-dioxolane |
| SMILES | C=CC1(CCC(=C)C)O[C@H](C)[C@@H](C)O1 |
| InChI | InChI=1S/C12H20O2/c1-6-12(8-7-9(2)3)13-10(4)11(5)14-12/h6,10-11H,1-2,7-8H2,3-5H3/t10-,11-/m1/s1 |
| InChIKey | ALZHZBPWBSNKKY-GHMZBOCLSA-N |
| XLogP | 3.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|