C14H25N3O3S — CID 106079946
5-[(cyclopropylamino)methyl]-N-(2-methoxy-2-methylpropyl)-1-methylpyrrole-3-sulfonamide (PubChem CID 106079946) has the molecular formula C14H25N3O3S and a molecular weight of 315.44 g/mol. Its IUPAC name is 5-[(cyclopropylamino)methyl]-N-(2-methoxy-2-methylpropyl)-1-methylpyrrole-3-sulfonamide.
| Compound Name | 5-[(cyclopropylamino)methyl]-N-(2-methoxy-2-methylpropyl)-1-methylpyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106079946 |
| Molecular Formula | C14H25N3O3S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 5-[(cyclopropylamino)methyl]-N-(2-methoxy-2-methylpropyl)-1-methylpyrrole-3-sulfonamide |
| SMILES | COC(C)(C)CNS(=O)(=O)c1cc(CNC2CC2)n(C)c1 |
| InChI | InChI=1S/C14H25N3O3S/c1-14(2,20-4)10-16-21(18,19)13-7-12(17(3)9-13)8-15-11-5-6-11/h7,9,11,15-16H,5-6,8,10H2,1-4H3 |
| InChIKey | MTYOYJKPEBZXQC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |