C8H10N2O4 — CID 10608004
methyl N-[(3aS,4R,6aR)-2-oxo-3,3a,4,6a-tetrahydrocyclopenta[d][1,3]oxazol-4-yl]carbamate (PubChem CID 10608004) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is methyl N-[(3aS,4R,6aR)-2-oxo-3,3a,4,6a-tetrahydrocyclopenta[d][1,3]oxazol-4-yl]carbamate.
| Compound Name | methyl N-[(3aS,4R,6aR)-2-oxo-3,3a,4,6a-tetrahydrocyclopenta[d][1,3]oxazol-4-yl]carbamate |
|---|---|
| PubChem CID | 10608004 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | methyl N-[(3aS,4R,6aR)-2-oxo-3,3a,4,6a-tetrahydrocyclopenta[d][1,3]oxazol-4-yl]carbamate |
| SMILES | COC(=O)N[C@@H]1C=C[C@H]2OC(=O)N[C@@H]12 |
| InChI | InChI=1S/C8H10N2O4/c1-13-7(11)9-4-2-3-5-6(4)10-8(12)14-5/h2-6H,1H3,(H,9,11)(H,10,12)/t4-,5-,6+/m1/s1 |
| InChIKey | IWJHUEFEVONAQG-PBXRRBTRSA-N |
| XLogP | -0.24 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|