About (6-chloro-3,5-dimethylpyrazin-2-yl) acetate
(6-chloro-3,5-dimethylpyrazin-2-yl) acetate (PubChem CID 10608117) has the molecular formula C8H9ClN2O2
and a molecular weight of 200.62 g/mol. Its IUPAC name is (6-chloro-3,5-dimethylpyrazin-2-yl) acetate.
Molecular Properties
| Compound Name | (6-chloro-3,5-dimethylpyrazin-2-yl) acetate |
| PubChem CID | 10608117 |
| Molecular Formula | C8H9ClN2O2 |
| Molecular Weight | 200.62 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | (6-chloro-3,5-dimethylpyrazin-2-yl) acetate |
| SMILES | CC(=O)Oc1nc(Cl)c(C)nc1C |
| InChI | InChI=1S/C8H9ClN2O2/c1-4-7(9)11-8(5(2)10-4)13-6(3)12/h1-3H3 |
| InChIKey | FDPYQSUDXUXQON-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.62 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-chloro-3,5-dimethylpyrazin-2-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-3,5-dimethylpyrazin-2-yl) acetate?
The IUPAC name of (6-chloro-3,5-dimethylpyrazin-2-yl) acetate (CID 10608117) is (6-chloro-3,5-dimethylpyrazin-2-yl) acetate.
What is the SMILES notation for (6-chloro-3,5-dimethylpyrazin-2-yl) acetate?
The canonical SMILES for (6-chloro-3,5-dimethylpyrazin-2-yl) acetate is CC(=O)Oc1nc(Cl)c(C)nc1C.
What is the InChIKey of (6-chloro-3,5-dimethylpyrazin-2-yl) acetate?
The InChIKey is FDPYQSUDXUXQON-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClN2O2/c1-4-7(9)11-8(5(2)10-4)13-6(3)12/h1-3H3.
What are the key properties of (6-chloro-3,5-dimethylpyrazin-2-yl) acetate?
(6-chloro-3,5-dimethylpyrazin-2-yl) acetate has a molecular weight of 200.62 g/mol, XLogP of 1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-3,5-dimethylpyrazin-2-yl) acetate is sourced from PubChem (CID 10608117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).