About 3-(aminomethyl)-2,4-difluoro-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide
3-(aminomethyl)-2,4-difluoro-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide (PubChem CID 106081783) has the molecular formula C11H10F2N4O3S
and a molecular weight of 316.29 g/mol. Its IUPAC name is 3-(aminomethyl)-2,4-difluoro-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 3-(aminomethyl)-2,4-difluoro-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide |
| PubChem CID | 106081783 |
| Molecular Formula | C11H10F2N4O3S |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 3-(aminomethyl)-2,4-difluoro-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide |
| SMILES | NCc1c(F)ccc(S(=O)(=O)Nc2ccc(=O)[nH]n2)c1F |
| InChI | InChI=1S/C11H10F2N4O3S/c12-7-1-2-8(11(13)6(7)5-14)21(19,20)17-9-3-4-10(18)16-15-9/h1-4H,5,14H2,(H,15,17)(H,16,18) |
| InChIKey | MPEXQWQQFHNFGL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(aminomethyl)-2,4-difluoro-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-2,4-difluoro-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide?
The IUPAC name of 3-(aminomethyl)-2,4-difluoro-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide (CID 106081783) is 3-(aminomethyl)-2,4-difluoro-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide.
What is the SMILES notation for 3-(aminomethyl)-2,4-difluoro-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide?
The canonical SMILES for 3-(aminomethyl)-2,4-difluoro-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide is NCc1c(F)ccc(S(=O)(=O)Nc2ccc(=O)[nH]n2)c1F.
What is the InChIKey of 3-(aminomethyl)-2,4-difluoro-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide?
The InChIKey is MPEXQWQQFHNFGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F2N4O3S/c12-7-1-2-8(11(13)6(7)5-14)21(19,20)17-9-3-4-10(18)16-15-9/h1-4H,5,14H2,(H,15,17)(H,16,18).
What are the key properties of 3-(aminomethyl)-2,4-difluoro-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide?
3-(aminomethyl)-2,4-difluoro-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide has a molecular weight of 316.29 g/mol, XLogP of 0.31, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-2,4-difluoro-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide is sourced from PubChem (CID 106081783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).