C11H15N5O2S2 — CID 106081920
5-[2-(ethylamino)ethyl]-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide (PubChem CID 106081920) has the molecular formula C11H15N5O2S2 and a molecular weight of 313.41 g/mol. Its IUPAC name is 5-[2-(ethylamino)ethyl]-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide.
| Compound Name | 5-[2-(ethylamino)ethyl]-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106081920 |
| Molecular Formula | C11H15N5O2S2 |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 5-[2-(ethylamino)ethyl]-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide |
| SMILES | CCNCCc1ccc(S(=O)(=O)Nc2nccnn2)s1 |
| InChI | InChI=1S/C11H15N5O2S2/c1-2-12-6-5-9-3-4-10(19-9)20(17,18)16-11-13-7-8-14-15-11/h3-4,7-8,12H,2,5-6H2,1H3,(H,13,15,16) |
| InChIKey | ZXOSOZDJYXGJTL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|