C12H17N5O2S2 — CID 106082010
5-[2-(propylamino)ethyl]-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide (PubChem CID 106082010) has the molecular formula C12H17N5O2S2 and a molecular weight of 327.44 g/mol. Its IUPAC name is 5-[2-(propylamino)ethyl]-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide.
| Compound Name | 5-[2-(propylamino)ethyl]-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106082010 |
| Molecular Formula | C12H17N5O2S2 |
| Molecular Weight | 327.44 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 5-[2-(propylamino)ethyl]-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide |
| SMILES | CCCNCCc1ccc(S(=O)(=O)Nc2nccnn2)s1 |
| InChI | InChI=1S/C12H17N5O2S2/c1-2-6-13-7-5-10-3-4-11(20-10)21(18,19)17-12-14-8-9-15-16-12/h3-4,8-9,13H,2,5-7H2,1H3,(H,14,16,17) |
| InChIKey | RKQJIGJRPUDKBD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.44 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|