C13H15N3O2S2 — CID 106082542
4-[(cyclopropylamino)methyl]-N-pyridin-2-ylthiophene-2-sulfonamide (PubChem CID 106082542) has the molecular formula C13H15N3O2S2 and a molecular weight of 309.42 g/mol. Its IUPAC name is 4-[(cyclopropylamino)methyl]-N-pyridin-2-ylthiophene-2-sulfonamide.
| Compound Name | 4-[(cyclopropylamino)methyl]-N-pyridin-2-ylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106082542 |
| Molecular Formula | C13H15N3O2S2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 4-[(cyclopropylamino)methyl]-N-pyridin-2-ylthiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccccn1)c1cc(CNC2CC2)cs1 |
| InChI | InChI=1S/C13H15N3O2S2/c17-20(18,16-12-3-1-2-6-14-12)13-7-10(9-19-13)8-15-11-4-5-11/h1-3,6-7,9,11,15H,4-5,8H2,(H,14,16) |
| InChIKey | FNJUYDFTRBTWGU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |