C12H14O3 — CID 10608343
(1'R,2'R,6'R,7'R)-spiro[1,3-dioxolane-2,8'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one (PubChem CID 10608343) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (1'R,2'R,6'R,7'R)-spiro[1,3-dioxolane-2,8'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one.
| Compound Name | (1'R,2'R,6'R,7'R)-spiro[1,3-dioxolane-2,8'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one |
|---|---|
| PubChem CID | 10608343 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (1'R,2'R,6'R,7'R)-spiro[1,3-dioxolane-2,8'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one |
| SMILES | O=C1C=C[C@@H]2[C@H]1[C@H]1CCC3(OCCO3)[C@@H]21 |
| InChI | InChI=1S/C12H14O3/c13-9-2-1-7-10(9)8-3-4-12(11(7)8)14-5-6-15-12/h1-2,7-8,10-11H,3-6H2/t7-,8-,10+,11+/m1/s1 |
| InChIKey | PTYVWOZSBUERQQ-HZQMYPQZSA-N |
| XLogP | 1.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |