About methyl 2-benzyl-4-oxobutanoate
methyl 2-benzyl-4-oxobutanoate (PubChem CID 10608348) has the molecular formula C12H14O3
and a molecular weight of 206.24 g/mol. Its IUPAC name is methyl 2-benzyl-4-oxobutanoate.
Molecular Properties
| Compound Name | methyl 2-benzyl-4-oxobutanoate |
| PubChem CID | 10608348 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | methyl 2-benzyl-4-oxobutanoate |
| SMILES | COC(=O)C(CC=O)Cc1ccccc1 |
| InChI | InChI=1S/C12H14O3/c1-15-12(14)11(7-8-13)9-10-5-3-2-4-6-10/h2-6,8,11H,7,9H2,1H3 |
| InChIKey | YDBGEPGTKRHCBJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-benzyl-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-benzyl-4-oxobutanoate?
The IUPAC name of methyl 2-benzyl-4-oxobutanoate (CID 10608348) is methyl 2-benzyl-4-oxobutanoate.
What is the SMILES notation for methyl 2-benzyl-4-oxobutanoate?
The canonical SMILES for methyl 2-benzyl-4-oxobutanoate is COC(=O)C(CC=O)Cc1ccccc1.
What is the InChIKey of methyl 2-benzyl-4-oxobutanoate?
The InChIKey is YDBGEPGTKRHCBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3/c1-15-12(14)11(7-8-13)9-10-5-3-2-4-6-10/h2-6,8,11H,7,9H2,1H3.
What are the key properties of methyl 2-benzyl-4-oxobutanoate?
methyl 2-benzyl-4-oxobutanoate has a molecular weight of 206.24 g/mol, XLogP of 1.61, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-benzyl-4-oxobutanoate is sourced from PubChem (CID 10608348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).