C11H10F2N4O2S — CID 106084130
3-(aminomethyl)-2,4-difluoro-N-pyridazin-3-ylbenzenesulfonamide (PubChem CID 106084130) has the molecular formula C11H10F2N4O2S and a molecular weight of 300.29 g/mol. Its IUPAC name is 3-(aminomethyl)-2,4-difluoro-N-pyridazin-3-ylbenzenesulfonamide.
| Compound Name | 3-(aminomethyl)-2,4-difluoro-N-pyridazin-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 106084130 |
| Molecular Formula | C11H10F2N4O2S |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 3-(aminomethyl)-2,4-difluoro-N-pyridazin-3-ylbenzenesulfonamide |
| SMILES | NCc1c(F)ccc(S(=O)(=O)Nc2cccnn2)c1F |
| InChI | InChI=1S/C11H10F2N4O2S/c12-8-3-4-9(11(13)7(8)6-14)20(18,19)17-10-2-1-5-15-16-10/h1-5H,6,14H2,(H,16,17) |
| InChIKey | KRZKHZXUOHVEFQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |