C13H19ClN2O2S2 — CID 106084371
2-chloro-5-(methylaminomethyl)-N-(thian-4-yl)benzenesulfonamide (PubChem CID 106084371) has the molecular formula C13H19ClN2O2S2 and a molecular weight of 334.89 g/mol. Its IUPAC name is 2-chloro-5-(methylaminomethyl)-N-(thian-4-yl)benzenesulfonamide.
| Compound Name | 2-chloro-5-(methylaminomethyl)-N-(thian-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106084371 |
| Molecular Formula | C13H19ClN2O2S2 |
| Molecular Weight | 334.89 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 2-chloro-5-(methylaminomethyl)-N-(thian-4-yl)benzenesulfonamide |
| SMILES | CNCc1ccc(Cl)c(S(=O)(=O)NC2CCSCC2)c1 |
| InChI | InChI=1S/C13H19ClN2O2S2/c1-15-9-10-2-3-12(14)13(8-10)20(17,18)16-11-4-6-19-7-5-11/h2-3,8,11,15-16H,4-7,9H2,1H3 |
| InChIKey | OSKCKNKXXQZTHS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.89 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |