C12H18O3 — CID 10608517
(2R,3aS,6aR)-2-cyclohexyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one (PubChem CID 10608517) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (2R,3aS,6aR)-2-cyclohexyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one.
| Compound Name | (2R,3aS,6aR)-2-cyclohexyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one |
|---|---|
| PubChem CID | 10608517 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (2R,3aS,6aR)-2-cyclohexyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one |
| SMILES | O=C1C[C@@H]2C[C@H](C3CCCCC3)O[C@@H]2O1 |
| InChI | InChI=1S/C12H18O3/c13-11-7-9-6-10(14-12(9)15-11)8-4-2-1-3-5-8/h8-10,12H,1-7H2/t9-,10+,12+/m0/s1 |
| InChIKey | URLPUOYAMYJFLH-HOSYDEDBSA-N |
| XLogP | 2.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |