About N-(1,3-dimethylpyrazol-4-yl)-1-[3-(methylaminomethyl)phenyl]methanesulfonamide
N-(1,3-dimethylpyrazol-4-yl)-1-[3-(methylaminomethyl)phenyl]methanesulfonamide (PubChem CID 106086054) has the molecular formula C14H20N4O2S
and a molecular weight of 308.41 g/mol. Its IUPAC name is N-(1,3-dimethylpyrazol-4-yl)-1-[3-(methylaminomethyl)phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-(1,3-dimethylpyrazol-4-yl)-1-[3-(methylaminomethyl)phenyl]methanesulfonamide |
| PubChem CID | 106086054 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N-(1,3-dimethylpyrazol-4-yl)-1-[3-(methylaminomethyl)phenyl]methanesulfonamide |
| SMILES | CNCc1cccc(CS(=O)(=O)Nc2cn(C)nc2C)c1 |
| InChI | InChI=1S/C14H20N4O2S/c1-11-14(9-18(3)16-11)17-21(19,20)10-13-6-4-5-12(7-13)8-15-2/h4-7,9,15,17H,8,10H2,1-3H3 |
| InChIKey | CIBSXIWLOHGDHM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1,3-dimethylpyrazol-4-yl)-1-[3-(methylaminomethyl)phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-dimethylpyrazol-4-yl)-1-[3-(methylaminomethyl)phenyl]methanesulfonamide?
The IUPAC name of N-(1,3-dimethylpyrazol-4-yl)-1-[3-(methylaminomethyl)phenyl]methanesulfonamide (CID 106086054) is N-(1,3-dimethylpyrazol-4-yl)-1-[3-(methylaminomethyl)phenyl]methanesulfonamide.
What is the SMILES notation for N-(1,3-dimethylpyrazol-4-yl)-1-[3-(methylaminomethyl)phenyl]methanesulfonamide?
The canonical SMILES for N-(1,3-dimethylpyrazol-4-yl)-1-[3-(methylaminomethyl)phenyl]methanesulfonamide is CNCc1cccc(CS(=O)(=O)Nc2cn(C)nc2C)c1.
What is the InChIKey of N-(1,3-dimethylpyrazol-4-yl)-1-[3-(methylaminomethyl)phenyl]methanesulfonamide?
The InChIKey is CIBSXIWLOHGDHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4O2S/c1-11-14(9-18(3)16-11)17-21(19,20)10-13-6-4-5-12(7-13)8-15-2/h4-7,9,15,17H,8,10H2,1-3H3.
What are the key properties of N-(1,3-dimethylpyrazol-4-yl)-1-[3-(methylaminomethyl)phenyl]methanesulfonamide?
N-(1,3-dimethylpyrazol-4-yl)-1-[3-(methylaminomethyl)phenyl]methanesulfonamide has a molecular weight of 308.41 g/mol, XLogP of 1.39, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-dimethylpyrazol-4-yl)-1-[3-(methylaminomethyl)phenyl]methanesulfonamide is sourced from PubChem (CID 106086054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).