C14H30N4O2S — CID 106087127
N-[[1-(dimethylamino)cyclobutyl]methyl]-4-(methylaminomethyl)piperidine-1-sulfonamide (PubChem CID 106087127) has the molecular formula C14H30N4O2S and a molecular weight of 318.49 g/mol. Its IUPAC name is N-[[1-(dimethylamino)cyclobutyl]methyl]-4-(methylaminomethyl)piperidine-1-sulfonamide.
| Compound Name | N-[[1-(dimethylamino)cyclobutyl]methyl]-4-(methylaminomethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106087127 |
| Molecular Formula | C14H30N4O2S |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | N-[[1-(dimethylamino)cyclobutyl]methyl]-4-(methylaminomethyl)piperidine-1-sulfonamide |
| SMILES | CNCC1CCN(S(=O)(=O)NCC2(N(C)C)CCC2)CC1 |
| InChI | InChI=1S/C14H30N4O2S/c1-15-11-13-5-9-18(10-6-13)21(19,20)16-12-14(17(2)3)7-4-8-14/h13,15-16H,4-12H2,1-3H3 |
| InChIKey | GATZMSNWVYBDNK-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |