C10H16O5 — CID 10608736
[(3aR,7R,7aS)-7-(methoxymethoxy)-3a,6,7,7a-tetrahydro-1,3-benzodioxol-5-yl]methanol (PubChem CID 10608736) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is [(3aR,7R,7aS)-7-(methoxymethoxy)-3a,6,7,7a-tetrahydro-1,3-benzodioxol-5-yl]methanol.
| Compound Name | [(3aR,7R,7aS)-7-(methoxymethoxy)-3a,6,7,7a-tetrahydro-1,3-benzodioxol-5-yl]methanol |
|---|---|
| PubChem CID | 10608736 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | [(3aR,7R,7aS)-7-(methoxymethoxy)-3a,6,7,7a-tetrahydro-1,3-benzodioxol-5-yl]methanol |
| SMILES | COCO[C@@H]1CC(CO)=C[C@H]2OCO[C@H]21 |
| InChI | InChI=1S/C10H16O5/c1-12-5-13-8-2-7(4-11)3-9-10(8)15-6-14-9/h3,8-11H,2,4-6H2,1H3/t8-,9-,10+/m1/s1 |
| InChIKey | MDCKXIZAZDYSTQ-BBBLOLIVSA-N |
| XLogP | 0.04 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|