About 5-[(4-fluoro-2,3-dihydro-1H-inden-2-yl)methyl]-4,5-dihydro-1H-imidazole
5-[(4-fluoro-2,3-dihydro-1H-inden-2-yl)methyl]-4,5-dihydro-1H-imidazole (PubChem CID 10608858) has the molecular formula C13H15FN2
and a molecular weight of 218.28 g/mol. Its IUPAC name is 5-[(4-fluoro-2,3-dihydro-1H-inden-2-yl)methyl]-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 5-[(4-fluoro-2,3-dihydro-1H-inden-2-yl)methyl]-4,5-dihydro-1H-imidazole |
| PubChem CID | 10608858 |
| Molecular Formula | C13H15FN2 |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 5-[(4-fluoro-2,3-dihydro-1H-inden-2-yl)methyl]-4,5-dihydro-1H-imidazole |
| SMILES | Fc1cccc2c1CC(CC1CN=CN1)C2 |
| InChI | InChI=1S/C13H15FN2/c14-13-3-1-2-10-4-9(6-12(10)13)5-11-7-15-8-16-11/h1-3,8-9,11H,4-7H2,(H,15,16) |
| InChIKey | LQJGPTUEUKGVLC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(4-fluoro-2,3-dihydro-1H-inden-2-yl)methyl]-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-fluoro-2,3-dihydro-1H-inden-2-yl)methyl]-4,5-dihydro-1H-imidazole?
The IUPAC name of 5-[(4-fluoro-2,3-dihydro-1H-inden-2-yl)methyl]-4,5-dihydro-1H-imidazole (CID 10608858) is 5-[(4-fluoro-2,3-dihydro-1H-inden-2-yl)methyl]-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 5-[(4-fluoro-2,3-dihydro-1H-inden-2-yl)methyl]-4,5-dihydro-1H-imidazole?
The canonical SMILES for 5-[(4-fluoro-2,3-dihydro-1H-inden-2-yl)methyl]-4,5-dihydro-1H-imidazole is Fc1cccc2c1CC(CC1CN=CN1)C2.
What is the InChIKey of 5-[(4-fluoro-2,3-dihydro-1H-inden-2-yl)methyl]-4,5-dihydro-1H-imidazole?
The InChIKey is LQJGPTUEUKGVLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FN2/c14-13-3-1-2-10-4-9(6-12(10)13)5-11-7-15-8-16-11/h1-3,8-9,11H,4-7H2,(H,15,16).
What are the key properties of 5-[(4-fluoro-2,3-dihydro-1H-inden-2-yl)methyl]-4,5-dihydro-1H-imidazole?
5-[(4-fluoro-2,3-dihydro-1H-inden-2-yl)methyl]-4,5-dihydro-1H-imidazole has a molecular weight of 218.28 g/mol, XLogP of 1.93, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-fluoro-2,3-dihydro-1H-inden-2-yl)methyl]-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 10608858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).