About (4-methoxyphenyl)-(1,3-thiazol-2-yl)methanone
(4-methoxyphenyl)-(1,3-thiazol-2-yl)methanone (PubChem CID 10608908) has the molecular formula C11H9NO2S
and a molecular weight of 219.26 g/mol. Its IUPAC name is (4-methoxyphenyl)-(1,3-thiazol-2-yl)methanone.
Molecular Properties
| Compound Name | (4-methoxyphenyl)-(1,3-thiazol-2-yl)methanone |
| PubChem CID | 10608908 |
| Molecular Formula | C11H9NO2S |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | (4-methoxyphenyl)-(1,3-thiazol-2-yl)methanone |
| SMILES | COc1ccc(C(=O)c2nccs2)cc1 |
| InChI | InChI=1S/C11H9NO2S/c1-14-9-4-2-8(3-5-9)10(13)11-12-6-7-15-11/h2-7H,1H3 |
| InChIKey | LXWFMRSPJYHGMI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-methoxyphenyl)-(1,3-thiazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)-(1,3-thiazol-2-yl)methanone?
The IUPAC name of (4-methoxyphenyl)-(1,3-thiazol-2-yl)methanone (CID 10608908) is (4-methoxyphenyl)-(1,3-thiazol-2-yl)methanone.
What is the SMILES notation for (4-methoxyphenyl)-(1,3-thiazol-2-yl)methanone?
The canonical SMILES for (4-methoxyphenyl)-(1,3-thiazol-2-yl)methanone is COc1ccc(C(=O)c2nccs2)cc1.
What is the InChIKey of (4-methoxyphenyl)-(1,3-thiazol-2-yl)methanone?
The InChIKey is LXWFMRSPJYHGMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2S/c1-14-9-4-2-8(3-5-9)10(13)11-12-6-7-15-11/h2-7H,1H3.
What are the key properties of (4-methoxyphenyl)-(1,3-thiazol-2-yl)methanone?
(4-methoxyphenyl)-(1,3-thiazol-2-yl)methanone has a molecular weight of 219.26 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)-(1,3-thiazol-2-yl)methanone is sourced from PubChem (CID 10608908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).