About 3-(aminomethyl)-2,4-difluoro-N-(pyridazin-3-ylmethyl)benzenesulfonamide
3-(aminomethyl)-2,4-difluoro-N-(pyridazin-3-ylmethyl)benzenesulfonamide (PubChem CID 106089495) has the molecular formula C12H12F2N4O2S
and a molecular weight of 314.32 g/mol. Its IUPAC name is 3-(aminomethyl)-2,4-difluoro-N-(pyridazin-3-ylmethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 3-(aminomethyl)-2,4-difluoro-N-(pyridazin-3-ylmethyl)benzenesulfonamide |
| PubChem CID | 106089495 |
| Molecular Formula | C12H12F2N4O2S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 3-(aminomethyl)-2,4-difluoro-N-(pyridazin-3-ylmethyl)benzenesulfonamide |
| SMILES | NCc1c(F)ccc(S(=O)(=O)NCc2cccnn2)c1F |
| InChI | InChI=1S/C12H12F2N4O2S/c13-10-3-4-11(12(14)9(10)6-15)21(19,20)17-7-8-2-1-5-16-18-8/h1-5,17H,6-7,15H2 |
| InChIKey | NNJABPXHPIEYHC-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(aminomethyl)-2,4-difluoro-N-(pyridazin-3-ylmethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-2,4-difluoro-N-(pyridazin-3-ylmethyl)benzenesulfonamide?
The IUPAC name of 3-(aminomethyl)-2,4-difluoro-N-(pyridazin-3-ylmethyl)benzenesulfonamide (CID 106089495) is 3-(aminomethyl)-2,4-difluoro-N-(pyridazin-3-ylmethyl)benzenesulfonamide.
What is the SMILES notation for 3-(aminomethyl)-2,4-difluoro-N-(pyridazin-3-ylmethyl)benzenesulfonamide?
The canonical SMILES for 3-(aminomethyl)-2,4-difluoro-N-(pyridazin-3-ylmethyl)benzenesulfonamide is NCc1c(F)ccc(S(=O)(=O)NCc2cccnn2)c1F.
What is the InChIKey of 3-(aminomethyl)-2,4-difluoro-N-(pyridazin-3-ylmethyl)benzenesulfonamide?
The InChIKey is NNJABPXHPIEYHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F2N4O2S/c13-10-3-4-11(12(14)9(10)6-15)21(19,20)17-7-8-2-1-5-16-18-8/h1-5,17H,6-7,15H2.
What are the key properties of 3-(aminomethyl)-2,4-difluoro-N-(pyridazin-3-ylmethyl)benzenesulfonamide?
3-(aminomethyl)-2,4-difluoro-N-(pyridazin-3-ylmethyl)benzenesulfonamide has a molecular weight of 314.32 g/mol, XLogP of 0.69, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-2,4-difluoro-N-(pyridazin-3-ylmethyl)benzenesulfonamide is sourced from PubChem (CID 106089495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).