C14H24N2O3S — CID 106089872
2-methyl-5-(methylaminomethyl)-N-[(3-methylcyclopentyl)methyl]furan-3-sulfonamide (PubChem CID 106089872) has the molecular formula C14H24N2O3S and a molecular weight of 300.42 g/mol. Its IUPAC name is 2-methyl-5-(methylaminomethyl)-N-[(3-methylcyclopentyl)methyl]furan-3-sulfonamide.
| Compound Name | 2-methyl-5-(methylaminomethyl)-N-[(3-methylcyclopentyl)methyl]furan-3-sulfonamide |
|---|---|
| PubChem CID | 106089872 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2-methyl-5-(methylaminomethyl)-N-[(3-methylcyclopentyl)methyl]furan-3-sulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)NCC2CCC(C)C2)c(C)o1 |
| InChI | InChI=1S/C14H24N2O3S/c1-10-4-5-12(6-10)8-16-20(17,18)14-7-13(9-15-3)19-11(14)2/h7,10,12,15-16H,4-6,8-9H2,1-3H3 |
| InChIKey | RZJYMTDFXURGCP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |