C13H16FN3O2S2 — CID 106090175
5-(ethylaminomethyl)-N-(3-fluoro-4-pyridinyl)-2-methylthiophene-3-sulfonamide (PubChem CID 106090175) has the molecular formula C13H16FN3O2S2 and a molecular weight of 329.42 g/mol. Its IUPAC name is 5-(ethylaminomethyl)-N-(3-fluoro-4-pyridinyl)-2-methylthiophene-3-sulfonamide.
| Compound Name | 5-(ethylaminomethyl)-N-(3-fluoro-4-pyridinyl)-2-methylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106090175 |
| Molecular Formula | C13H16FN3O2S2 |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 5-(ethylaminomethyl)-N-(3-fluoro-4-pyridinyl)-2-methylthiophene-3-sulfonamide |
| SMILES | CCNCc1cc(S(=O)(=O)Nc2ccncc2F)c(C)s1 |
| InChI | InChI=1S/C13H16FN3O2S2/c1-3-15-7-10-6-13(9(2)20-10)21(18,19)17-12-4-5-16-8-11(12)14/h4-6,8,15H,3,7H2,1-2H3,(H,16,17) |
| InChIKey | VOOOVZGFFFJWKI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |