C15H27N — CID 10609028
1-butyl-2,4-diethyl-3-propylpyrrole (PubChem CID 10609028) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is 1-butyl-2,4-diethyl-3-propylpyrrole.
| Compound Name | 1-butyl-2,4-diethyl-3-propylpyrrole |
|---|---|
| PubChem CID | 10609028 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 1-butyl-2,4-diethyl-3-propylpyrrole |
| SMILES | CCCCn1cc(CC)c(CCC)c1CC |
| InChI | InChI=1S/C15H27N/c1-5-9-11-16-12-13(7-3)14(10-6-2)15(16)8-4/h12H,5-11H2,1-4H3 |
| InChIKey | AIBOKYYMIHEDFC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |