C14H25N3O2S2 — CID 106090752
5-(aminomethyl)-1-ethyl-N-(4-methylsulfanylcyclohexyl)pyrrole-3-sulfonamide (PubChem CID 106090752) has the molecular formula C14H25N3O2S2 and a molecular weight of 331.51 g/mol. Its IUPAC name is 5-(aminomethyl)-1-ethyl-N-(4-methylsulfanylcyclohexyl)pyrrole-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-1-ethyl-N-(4-methylsulfanylcyclohexyl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106090752 |
| Molecular Formula | C14H25N3O2S2 |
| Molecular Weight | 331.51 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 5-(aminomethyl)-1-ethyl-N-(4-methylsulfanylcyclohexyl)pyrrole-3-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NC2CCC(SC)CC2)cc1CN |
| InChI | InChI=1S/C14H25N3O2S2/c1-3-17-10-14(8-12(17)9-15)21(18,19)16-11-4-6-13(20-2)7-5-11/h8,10-11,13,16H,3-7,9,15H2,1-2H3 |
| InChIKey | DXMLWGAIIHXFME-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.51 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |