C15H29N3O2S — CID 106091198
3-[(cyclopropylamino)methyl]-N-(2-cyclopropylpropan-2-yl)piperidine-1-sulfonamide (PubChem CID 106091198) has the molecular formula C15H29N3O2S and a molecular weight of 315.48 g/mol. Its IUPAC name is 3-[(cyclopropylamino)methyl]-N-(2-cyclopropylpropan-2-yl)piperidine-1-sulfonamide.
| Compound Name | 3-[(cyclopropylamino)methyl]-N-(2-cyclopropylpropan-2-yl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106091198 |
| Molecular Formula | C15H29N3O2S |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | 3-[(cyclopropylamino)methyl]-N-(2-cyclopropylpropan-2-yl)piperidine-1-sulfonamide |
| SMILES | CC(C)(NS(=O)(=O)N1CCCC(CNC2CC2)C1)C1CC1 |
| InChI | InChI=1S/C15H29N3O2S/c1-15(2,13-5-6-13)17-21(19,20)18-9-3-4-12(11-18)10-16-14-7-8-14/h12-14,16-17H,3-11H2,1-2H3 |
| InChIKey | KTEBATLQSVPLFB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |