C10H18F2N4O3S — CID 106091832
N-[2-(2,2-difluoroethoxy)ethyl]-5-methyl-3-(methylaminomethyl)-1H-pyrazole-4-sulfonamide (PubChem CID 106091832) has the molecular formula C10H18F2N4O3S and a molecular weight of 312.34 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-5-methyl-3-(methylaminomethyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-5-methyl-3-(methylaminomethyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106091832 |
| Molecular Formula | C10H18F2N4O3S |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-5-methyl-3-(methylaminomethyl)-1H-pyrazole-4-sulfonamide |
| SMILES | CNCc1n[nH]c(C)c1S(=O)(=O)NCCOCC(F)F |
| InChI | InChI=1S/C10H18F2N4O3S/c1-7-10(8(5-13-2)16-15-7)20(17,18)14-3-4-19-6-9(11)12/h9,13-14H,3-6H2,1-2H3,(H,15,16) |
| InChIKey | VWMGWCPYBWHIOB-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|