C11H24F2N2O3S — CID 106091842
N-[2-(2,2-difluoroethoxy)ethyl]-4-(propan-2-ylamino)butane-1-sulfonamide (PubChem CID 106091842) has the molecular formula C11H24F2N2O3S and a molecular weight of 302.39 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-4-(propan-2-ylamino)butane-1-sulfonamide.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-4-(propan-2-ylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106091842 |
| Molecular Formula | C11H24F2N2O3S |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-4-(propan-2-ylamino)butane-1-sulfonamide |
| SMILES | CC(C)NCCCCS(=O)(=O)NCCOCC(F)F |
| InChI | InChI=1S/C11H24F2N2O3S/c1-10(2)14-5-3-4-8-19(16,17)15-6-7-18-9-11(12)13/h10-11,14-15H,3-9H2,1-2H3 |
| InChIKey | DEKJAEWXPPNGNQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|