C13H20O3 — CID 10609188
methyl (4aR,8aR)-3-methyl-8-oxo-1,2,3,4,5,6,7,8a-octahydronaphthalene-4a-carboxylate (PubChem CID 10609188) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is methyl (4aR,8aR)-3-methyl-8-oxo-1,2,3,4,5,6,7,8a-octahydronaphthalene-4a-carboxylate.
| Compound Name | methyl (4aR,8aR)-3-methyl-8-oxo-1,2,3,4,5,6,7,8a-octahydronaphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 10609188 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | methyl (4aR,8aR)-3-methyl-8-oxo-1,2,3,4,5,6,7,8a-octahydronaphthalene-4a-carboxylate |
| SMILES | COC(=O)[C@@]12CCCC(=O)[C@@H]1CCC(C)C2 |
| InChI | InChI=1S/C13H20O3/c1-9-5-6-10-11(14)4-3-7-13(10,8-9)12(15)16-2/h9-10H,3-8H2,1-2H3/t9?,10-,13+/m0/s1 |
| InChIKey | NAMCUCDGODUDLP-QQIFVLEESA-N |
| XLogP | 2.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |