C10H21F2N3O3S — CID 106091932
2-(aminomethyl)-N-[2-(2,2-difluoroethoxy)ethyl]piperidine-1-sulfonamide (PubChem CID 106091932) has the molecular formula C10H21F2N3O3S and a molecular weight of 301.36 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[2-(2,2-difluoroethoxy)ethyl]piperidine-1-sulfonamide.
| Compound Name | 2-(aminomethyl)-N-[2-(2,2-difluoroethoxy)ethyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106091932 |
| Molecular Formula | C10H21F2N3O3S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-(aminomethyl)-N-[2-(2,2-difluoroethoxy)ethyl]piperidine-1-sulfonamide |
| SMILES | NCC1CCCCN1S(=O)(=O)NCCOCC(F)F |
| InChI | InChI=1S/C10H21F2N3O3S/c11-10(12)8-18-6-4-14-19(16,17)15-5-2-1-3-9(15)7-13/h9-10,14H,1-8,13H2 |
| InChIKey | CWAJOMKUENQGRO-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|