C14H26N2O2S3 — CID 106093653
2-(ethylaminomethyl)-4-methyl-N-(5-methylsulfanylpentyl)thiophene-3-sulfonamide (PubChem CID 106093653) has the molecular formula C14H26N2O2S3 and a molecular weight of 350.58 g/mol. Its IUPAC name is 2-(ethylaminomethyl)-4-methyl-N-(5-methylsulfanylpentyl)thiophene-3-sulfonamide.
| Compound Name | 2-(ethylaminomethyl)-4-methyl-N-(5-methylsulfanylpentyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106093653 |
| Molecular Formula | C14H26N2O2S3 |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 2-(ethylaminomethyl)-4-methyl-N-(5-methylsulfanylpentyl)thiophene-3-sulfonamide |
| SMILES | CCNCc1scc(C)c1S(=O)(=O)NCCCCCSC |
| InChI | InChI=1S/C14H26N2O2S3/c1-4-15-10-13-14(12(2)11-20-13)21(17,18)16-8-6-5-7-9-19-3/h11,15-16H,4-10H2,1-3H3 |
| InChIKey | MKLWHMKBQFRARP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|