About 5-(trifluoromethyl)-1,3-benzothiazole-2-carbonitrile
5-(trifluoromethyl)-1,3-benzothiazole-2-carbonitrile (PubChem CID 10609373) has the molecular formula C9H3F3N2S
and a molecular weight of 228.20 g/mol. Its IUPAC name is 5-(trifluoromethyl)-1,3-benzothiazole-2-carbonitrile.
Molecular Properties
| Compound Name | 5-(trifluoromethyl)-1,3-benzothiazole-2-carbonitrile |
| PubChem CID | 10609373 |
| Molecular Formula | C9H3F3N2S |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 5-(trifluoromethyl)-1,3-benzothiazole-2-carbonitrile |
| SMILES | N#Cc1nc2cc(C(F)(F)F)ccc2s1 |
| InChI | InChI=1S/C9H3F3N2S/c10-9(11,12)5-1-2-7-6(3-5)14-8(4-13)15-7/h1-3H |
| InChIKey | BVMFYBPWYIOKQO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(trifluoromethyl)-1,3-benzothiazole-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(trifluoromethyl)-1,3-benzothiazole-2-carbonitrile?
The IUPAC name of 5-(trifluoromethyl)-1,3-benzothiazole-2-carbonitrile (CID 10609373) is 5-(trifluoromethyl)-1,3-benzothiazole-2-carbonitrile.
What is the SMILES notation for 5-(trifluoromethyl)-1,3-benzothiazole-2-carbonitrile?
The canonical SMILES for 5-(trifluoromethyl)-1,3-benzothiazole-2-carbonitrile is N#Cc1nc2cc(C(F)(F)F)ccc2s1.
What is the InChIKey of 5-(trifluoromethyl)-1,3-benzothiazole-2-carbonitrile?
The InChIKey is BVMFYBPWYIOKQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3F3N2S/c10-9(11,12)5-1-2-7-6(3-5)14-8(4-13)15-7/h1-3H.
What are the key properties of 5-(trifluoromethyl)-1,3-benzothiazole-2-carbonitrile?
5-(trifluoromethyl)-1,3-benzothiazole-2-carbonitrile has a molecular weight of 228.20 g/mol, XLogP of 3.19, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(trifluoromethyl)-1,3-benzothiazole-2-carbonitrile is sourced from PubChem (CID 10609373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).