About 1-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclohexan-1-ol
1-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclohexan-1-ol (PubChem CID 10609419) has the molecular formula C16H20O
and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclohexan-1-ol |
| PubChem CID | 10609419 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 1-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclohexan-1-ol |
| SMILES | OC1(/C=C/C=C/c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C16H20O/c17-16(12-6-2-7-13-16)14-8-5-11-15-9-3-1-4-10-15/h1,3-5,8-11,14,17H,2,6-7,12-13H2/b11-5+,14-8+ |
| InChIKey | PUFRWZBAQAKURW-XMGZOKRTSA-N |
| XLogP | 3.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclohexan-1-ol?
The IUPAC name of 1-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclohexan-1-ol (CID 10609419) is 1-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclohexan-1-ol.
What is the SMILES notation for 1-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclohexan-1-ol?
The canonical SMILES for 1-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclohexan-1-ol is OC1(/C=C/C=C/c2ccccc2)CCCCC1.
What is the InChIKey of 1-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclohexan-1-ol?
The InChIKey is PUFRWZBAQAKURW-XMGZOKRTSA-N. The full InChI is InChI=1S/C16H20O/c17-16(12-6-2-7-13-16)14-8-5-11-15-9-3-1-4-10-15/h1,3-5,8-11,14,17H,2,6-7,12-13H2/b11-5+,14-8+.
What are the key properties of 1-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclohexan-1-ol?
1-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclohexan-1-ol has a molecular weight of 228.34 g/mol, XLogP of 3.95, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclohexan-1-ol is sourced from PubChem (CID 10609419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).