C15H20O2 — CID 10609626
(1S,5S,9R,12S)-2,4-dioxatetracyclo[7.6.2.05,17.012,16]heptadeca-10,16-diene (PubChem CID 10609626) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (1S,5S,9R,12S)-2,4-dioxatetracyclo[7.6.2.05,17.012,16]heptadeca-10,16-diene.
| Compound Name | (1S,5S,9R,12S)-2,4-dioxatetracyclo[7.6.2.05,17.012,16]heptadeca-10,16-diene |
|---|---|
| PubChem CID | 10609626 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (1S,5S,9R,12S)-2,4-dioxatetracyclo[7.6.2.05,17.012,16]heptadeca-10,16-diene |
| SMILES | C1=C[C@H]2CCC[C@@H]3OCO[C@H]4CCC[C@@H]1C4=C32 |
| InChI | InChI=1S/C15H20O2/c1-3-10-7-8-11-4-2-6-13-15(11)14(10)12(5-1)16-9-17-13/h7-8,10-13H,1-6,9H2/t10-,11+,12-,13-/m0/s1 |
| InChIKey | ANRYADVECHDSMI-RNJOBUHISA-N |
| XLogP | 3.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|