About 3-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanamide
3-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanamide (PubChem CID 106096636) has the molecular formula C15H21N3O2
and a molecular weight of 275.35 g/mol. Its IUPAC name is 3-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanamide.
Molecular Properties
| Compound Name | 3-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanamide |
| PubChem CID | 106096636 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 3-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanamide |
| SMILES | CC(C)(CC(N)=O)NC(=O)CC1CNc2ccccc21 |
| InChI | InChI=1S/C15H21N3O2/c1-15(2,8-13(16)19)18-14(20)7-10-9-17-12-6-4-3-5-11(10)12/h3-6,10,17H,7-9H2,1-2H3,(H2,16,19)(H,18,20) |
| InChIKey | UNPQWDYVKDTZGH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanamide?
The IUPAC name of 3-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanamide (CID 106096636) is 3-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanamide.
What is the SMILES notation for 3-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanamide?
The canonical SMILES for 3-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanamide is CC(C)(CC(N)=O)NC(=O)CC1CNc2ccccc21.
What is the InChIKey of 3-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanamide?
The InChIKey is UNPQWDYVKDTZGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O2/c1-15(2,8-13(16)19)18-14(20)7-10-9-17-12-6-4-3-5-11(10)12/h3-6,10,17H,7-9H2,1-2H3,(H2,16,19)(H,18,20).
What are the key properties of 3-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanamide?
3-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanamide has a molecular weight of 275.35 g/mol, XLogP of 1.36, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]-3-methylbutanamide is sourced from PubChem (CID 106096636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).