C7H15N3O3S2 — CID 106096763
3-[(2-amino-2-sulfanylideneethyl)sulfonylamino]-3-methylbutanamide (PubChem CID 106096763) has the molecular formula C7H15N3O3S2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 3-[(2-amino-2-sulfanylideneethyl)sulfonylamino]-3-methylbutanamide.
| Compound Name | 3-[(2-amino-2-sulfanylideneethyl)sulfonylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106096763 |
| Molecular Formula | C7H15N3O3S2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 3-[(2-amino-2-sulfanylideneethyl)sulfonylamino]-3-methylbutanamide |
| SMILES | CC(C)(CC(N)=O)NS(=O)(=O)CC(N)=S |
| InChI | InChI=1S/C7H15N3O3S2/c1-7(2,3-5(8)11)10-15(12,13)4-6(9)14/h10H,3-4H2,1-2H3,(H2,8,11)(H2,9,14) |
| InChIKey | YRAACEUHRVIUKK-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|