C9H13FN4O — CID 106097186
3-[(5-fluoropyrimidin-2-yl)amino]-3-methylbutanamide (PubChem CID 106097186) has the molecular formula C9H13FN4O and a molecular weight of 212.23 g/mol. Its IUPAC name is 3-[(5-fluoropyrimidin-2-yl)amino]-3-methylbutanamide.
| Compound Name | 3-[(5-fluoropyrimidin-2-yl)amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106097186 |
| Molecular Formula | C9H13FN4O |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 3-[(5-fluoropyrimidin-2-yl)amino]-3-methylbutanamide |
| SMILES | CC(C)(CC(N)=O)Nc1ncc(F)cn1 |
| InChI | InChI=1S/C9H13FN4O/c1-9(2,3-7(11)15)14-8-12-4-6(10)5-13-8/h4-5H,3H2,1-2H3,(H2,11,15)(H,12,13,14) |
| InChIKey | LDMLPKYDCKPSHC-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |