C14H18O3 — CID 10609740
ethyl 2-[(1S,2R,3S,6S,7R)-5-oxo-3-tricyclo[5.2.1.02,6]dec-8-enyl]acetate (PubChem CID 10609740) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is ethyl 2-[(1S,2R,3S,6S,7R)-5-oxo-3-tricyclo[5.2.1.02,6]dec-8-enyl]acetate.
| Compound Name | ethyl 2-[(1S,2R,3S,6S,7R)-5-oxo-3-tricyclo[5.2.1.02,6]dec-8-enyl]acetate |
|---|---|
| PubChem CID | 10609740 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | ethyl 2-[(1S,2R,3S,6S,7R)-5-oxo-3-tricyclo[5.2.1.02,6]dec-8-enyl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CC(=O)[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C14H18O3/c1-2-17-12(16)7-10-6-11(15)14-9-4-3-8(5-9)13(10)14/h3-4,8-10,13-14H,2,5-7H2,1H3/t8-,9+,10+,13+,14-/m1/s1 |
| InChIKey | CPJWXJFSMCTKRM-SJPOPJSGSA-N |
| XLogP | 1.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|