About 3-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)-3-methylbutanamide
3-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)-3-methylbutanamide (PubChem CID 106097569) has the molecular formula C9H17N3OS
and a molecular weight of 215.32 g/mol. Its IUPAC name is 3-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)-3-methylbutanamide.
Molecular Properties
| Compound Name | 3-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)-3-methylbutanamide |
| PubChem CID | 106097569 |
| Molecular Formula | C9H17N3OS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 3-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)-3-methylbutanamide |
| SMILES | CC(C)(CC(N)=O)NC1=NCCCS1 |
| InChI | InChI=1S/C9H17N3OS/c1-9(2,6-7(10)13)12-8-11-4-3-5-14-8/h3-6H2,1-2H3,(H2,10,13)(H,11,12) |
| InChIKey | ADRWDPXYKUAALM-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)-3-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)-3-methylbutanamide?
The IUPAC name of 3-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)-3-methylbutanamide (CID 106097569) is 3-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)-3-methylbutanamide.
What is the SMILES notation for 3-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)-3-methylbutanamide?
The canonical SMILES for 3-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)-3-methylbutanamide is CC(C)(CC(N)=O)NC1=NCCCS1.
What is the InChIKey of 3-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)-3-methylbutanamide?
The InChIKey is ADRWDPXYKUAALM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3OS/c1-9(2,6-7(10)13)12-8-11-4-3-5-14-8/h3-6H2,1-2H3,(H2,10,13)(H,11,12).
What are the key properties of 3-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)-3-methylbutanamide?
3-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)-3-methylbutanamide has a molecular weight of 215.32 g/mol, XLogP of 0.72, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)-3-methylbutanamide is sourced from PubChem (CID 106097569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).