About 3-[(4-ethyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-3-methylbutanamide
3-[(4-ethyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-3-methylbutanamide (PubChem CID 106097574) has the molecular formula C10H19N3OS
and a molecular weight of 229.35 g/mol. Its IUPAC name is 3-[(4-ethyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-3-methylbutanamide.
Molecular Properties
| Compound Name | 3-[(4-ethyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-3-methylbutanamide |
| PubChem CID | 106097574 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 3-[(4-ethyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-3-methylbutanamide |
| SMILES | CCC1CSC(NC(C)(C)CC(N)=O)=N1 |
| InChI | InChI=1S/C10H19N3OS/c1-4-7-6-15-9(12-7)13-10(2,3)5-8(11)14/h7H,4-6H2,1-3H3,(H2,11,14)(H,12,13) |
| InChIKey | ZAOSGOUTDIBTSJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4-ethyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-3-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-ethyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-3-methylbutanamide?
The IUPAC name of 3-[(4-ethyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-3-methylbutanamide (CID 106097574) is 3-[(4-ethyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-3-methylbutanamide.
What is the SMILES notation for 3-[(4-ethyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-3-methylbutanamide?
The canonical SMILES for 3-[(4-ethyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-3-methylbutanamide is CCC1CSC(NC(C)(C)CC(N)=O)=N1.
What is the InChIKey of 3-[(4-ethyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-3-methylbutanamide?
The InChIKey is ZAOSGOUTDIBTSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3OS/c1-4-7-6-15-9(12-7)13-10(2,3)5-8(11)14/h7H,4-6H2,1-3H3,(H2,11,14)(H,12,13).
What are the key properties of 3-[(4-ethyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-3-methylbutanamide?
3-[(4-ethyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-3-methylbutanamide has a molecular weight of 229.35 g/mol, XLogP of 1.11, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-ethyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-3-methylbutanamide is sourced from PubChem (CID 106097574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).