C8H11Cl2N5O — CID 106098053
3-[(3,6-dichloro-1,2,4-triazin-5-yl)amino]-3-methylbutanamide (PubChem CID 106098053) has the molecular formula C8H11Cl2N5O and a molecular weight of 264.12 g/mol. Its IUPAC name is 3-[(3,6-dichloro-1,2,4-triazin-5-yl)amino]-3-methylbutanamide.
| Compound Name | 3-[(3,6-dichloro-1,2,4-triazin-5-yl)amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106098053 |
| Molecular Formula | C8H11Cl2N5O |
| Molecular Weight | 264.12 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 3-[(3,6-dichloro-1,2,4-triazin-5-yl)amino]-3-methylbutanamide |
| SMILES | CC(C)(CC(N)=O)Nc1nc(Cl)nnc1Cl |
| InChI | InChI=1S/C8H11Cl2N5O/c1-8(2,3-4(11)16)13-6-5(9)14-15-7(10)12-6/h3H2,1-2H3,(H2,11,16)(H,12,13,15) |
| InChIKey | VZVCCXLFFQAQGV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.12 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |