C16H20N2O3 — CID 106098195
N-(4-amino-2-methyl-4-oxobutan-2-yl)-3-(3-hydroxyprop-1-ynyl)-2-methylbenzamide (PubChem CID 106098195) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is N-(4-amino-2-methyl-4-oxobutan-2-yl)-3-(3-hydroxyprop-1-ynyl)-2-methylbenzamide.
| Compound Name | N-(4-amino-2-methyl-4-oxobutan-2-yl)-3-(3-hydroxyprop-1-ynyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 106098195 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N-(4-amino-2-methyl-4-oxobutan-2-yl)-3-(3-hydroxyprop-1-ynyl)-2-methylbenzamide |
| SMILES | Cc1c(C#CCO)cccc1C(=O)NC(C)(C)CC(N)=O |
| InChI | InChI=1S/C16H20N2O3/c1-11-12(7-5-9-19)6-4-8-13(11)15(21)18-16(2,3)10-14(17)20/h4,6,8,19H,9-10H2,1-3H3,(H2,17,20)(H,18,21) |
| InChIKey | YPNCDCACLYDCGC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|