C13H17ClN2O3 — CID 106099080
4-amino-2-chloro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzamide (PubChem CID 106099080) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is 4-amino-2-chloro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzamide.
| Compound Name | 4-amino-2-chloro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 106099080 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 4-amino-2-chloro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzamide |
| SMILES | CC1OCCC1(O)CNC(=O)c1ccc(N)cc1Cl |
| InChI | InChI=1S/C13H17ClN2O3/c1-8-13(18,4-5-19-8)7-16-12(17)10-3-2-9(15)6-11(10)14/h2-3,6,8,18H,4-5,7,15H2,1H3,(H,16,17) |
| InChIKey | HSRYQRUKLRLNOD-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|