C11H17N3O4S — CID 106099461
3-amino-5-[(3-hydroxyoxolan-3-yl)methylamino]benzenesulfonamide (PubChem CID 106099461) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is 3-amino-5-[(3-hydroxyoxolan-3-yl)methylamino]benzenesulfonamide.
| Compound Name | 3-amino-5-[(3-hydroxyoxolan-3-yl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 106099461 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 3-amino-5-[(3-hydroxyoxolan-3-yl)methylamino]benzenesulfonamide |
| SMILES | Nc1cc(NCC2(O)CCOC2)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H17N3O4S/c12-8-3-9(5-10(4-8)19(13,16)17)14-6-11(15)1-2-18-7-11/h3-5,14-15H,1-2,6-7,12H2,(H2,13,16,17) |
| InChIKey | WFWQRKOIPLHYCS-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|