About 3-[[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]methyl]-2-methyloxolan-3-ol
3-[[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]methyl]-2-methyloxolan-3-ol (PubChem CID 106099606) has the molecular formula C14H19N3O2S
and a molecular weight of 293.39 g/mol. Its IUPAC name is 3-[[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]methyl]-2-methyloxolan-3-ol.
Molecular Properties
| Compound Name | 3-[[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]methyl]-2-methyloxolan-3-ol |
| PubChem CID | 106099606 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 3-[[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]methyl]-2-methyloxolan-3-ol |
| SMILES | Cc1nc2cc(NCC3(O)CCOC3C)c(N)cc2s1 |
| InChI | InChI=1S/C14H19N3O2S/c1-8-14(18,3-4-19-8)7-16-11-6-12-13(5-10(11)15)20-9(2)17-12/h5-6,8,16,18H,3-4,7,15H2,1-2H3 |
| InChIKey | NMEKNLFSYDYUNQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]methyl]-2-methyloxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]methyl]-2-methyloxolan-3-ol?
The IUPAC name of 3-[[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]methyl]-2-methyloxolan-3-ol (CID 106099606) is 3-[[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]methyl]-2-methyloxolan-3-ol.
What is the SMILES notation for 3-[[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]methyl]-2-methyloxolan-3-ol?
The canonical SMILES for 3-[[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]methyl]-2-methyloxolan-3-ol is Cc1nc2cc(NCC3(O)CCOC3C)c(N)cc2s1.
What is the InChIKey of 3-[[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]methyl]-2-methyloxolan-3-ol?
The InChIKey is NMEKNLFSYDYUNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O2S/c1-8-14(18,3-4-19-8)7-16-11-6-12-13(5-10(11)15)20-9(2)17-12/h5-6,8,16,18H,3-4,7,15H2,1-2H3.
What are the key properties of 3-[[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]methyl]-2-methyloxolan-3-ol?
3-[[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]methyl]-2-methyloxolan-3-ol has a molecular weight of 293.39 g/mol, XLogP of 2.14, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]methyl]-2-methyloxolan-3-ol is sourced from PubChem (CID 106099606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).