C8H15F2NO2 — CID 106099939
3-[(1,1-difluoropropan-2-ylamino)methyl]oxolan-3-ol (PubChem CID 106099939) has the molecular formula C8H15F2NO2 and a molecular weight of 195.21 g/mol. Its IUPAC name is 3-[(1,1-difluoropropan-2-ylamino)methyl]oxolan-3-ol.
| Compound Name | 3-[(1,1-difluoropropan-2-ylamino)methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 106099939 |
| Molecular Formula | C8H15F2NO2 |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 3-[(1,1-difluoropropan-2-ylamino)methyl]oxolan-3-ol |
| SMILES | CC(NCC1(O)CCOC1)C(F)F |
| InChI | InChI=1S/C8H15F2NO2/c1-6(7(9)10)11-4-8(12)2-3-13-5-8/h6-7,11-12H,2-5H2,1H3 |
| InChIKey | KOGMSEFIIQEEGE-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |